C38H39F5N2O8S — CID 159554659
[8',10'-difluoro-2',2',4'-trimethyl-1'-(7-morpholin-4-yl-4-oxoheptyl)-3-oxospiro[2-benzofuran-1,6'-3,4-dihydrochromeno[3,2-g]quinoline]-9'-yl] trifluoromethanesulfonate (PubChem CID 159554659) has the molecular formula C38H39F5N2O8S and a molecular weight of 778.79 g/mol. Its IUPAC name is [8',10'-difluoro-2',2',4'-trimethyl-1'-(7-morpholin-4-yl-4-oxoheptyl)-3-oxospiro[2-benzofuran-1,6'-3,4-dihydrochromeno[3,2-g]quinoline]-9'-yl] trifluoromethanesulfonate.
| Compound Name | [8',10'-difluoro-2',2',4'-trimethyl-1'-(7-morpholin-4-yl-4-oxoheptyl)-3-oxospiro[2-benzofuran-1,6'-3,4-dihydrochromeno[3,2-g]quinoline]-9'-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 159554659 |
| Molecular Formula | C38H39F5N2O8S |
| Molecular Weight | 778.79 g/mol |
| Exact Mass | 778.23 |
| IUPAC Name | [8',10'-difluoro-2',2',4'-trimethyl-1'-(7-morpholin-4-yl-4-oxoheptyl)-3-oxospiro[2-benzofuran-1,6'-3,4-dihydrochromeno[3,2-g]quinoline]-9'-yl] trifluoromethanesulfonate |
| SMILES | CC1CC(C)(C)N(CCCC(=O)CCCN2CCOCC2)c2cc3c(cc21)C1(OC(=O)c2ccccc21)c1cc(F)c(OS(=O)(=O)C(F)(F)F)c(F)c1O3 |
| InChI | InChI=1S/C38H39F5N2O8S/c1-22-21-36(2,3)45(13-7-9-23(46)8-6-12-44-14-16-50-17-15-44)30-20-31-27(18-25(22)30)37(26-11-5-4-10-24(26)35(47)52-37)28-19-29(39)34(32(40)33(28)51-31)53-54(48,49)38(41,42)43/h4-5,10-11,18-20,22H,6-9,12-17,21H2,1-3H3 |
| InChIKey | MLECIYLRMTXUAI-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.79 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|