About CID 159555012
CID 159555012 (PubChem CID 159555012) has the molecular formula C44H30Br2F6N8O5S4
and a molecular weight of 1154.85 g/mol.
Molecular Properties
| Compound Name | CID 159555012 |
| PubChem CID | 159555012 |
| Molecular Formula | C44H30Br2F6N8O5S4 |
| Molecular Weight | 1154.85 g/mol |
| Exact Mass | 1151.96 |
| IUPAC Name | — |
| SMILES | COc1ccc(CN(c2ncns2)S(=O)(=O)c2ccc3c(-c4ccc(C(F)(F)F)cc4Br)nccc3c2)cc1.O=S(=O)(Nc1ncns1)c1ccc2c(-c3ccc(C(F)(F)F)cc3Br)nccc2c1.[2H][2H] |
| InChI | InChI=1S/C26H18BrF3N4O3S2.C18H10BrF3N4O2S2.H2/c1-37-19-5-2-16(3-6-19)14-34(25-32-15-33-38-25)39(35,36)20-7-9-21-17(12-20)10-11-31-24(21)22-8-4-18(13-23(22)27)26(28,29)30;19-15-8-11(18(20,21)22)1-3-14(15)16-13-4-2-12(7-10(13)5-6-23-16)30(27,28)26-17-24-9-25-29-17;/h2-13,15H,14H2,1H3;1-9H,(H,24,25,26);1H/i;;1+1D |
| InChIKey | MFWKCYMAXJJFJD-HNLLKZFVSA-N |
| XLogP | 12.52 |
| TPSA | 170.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 69 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1154.85 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
Analyze CID 159555012 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159555012?
The IUPAC name of CID 159555012 (CID 159555012) is not available.
What is the SMILES notation for CID 159555012?
The canonical SMILES for CID 159555012 is COc1ccc(CN(c2ncns2)S(=O)(=O)c2ccc3c(-c4ccc(C(F)(F)F)cc4Br)nccc3c2)cc1.O=S(=O)(Nc1ncns1)c1ccc2c(-c3ccc(C(F)(F)F)cc3Br)nccc2c1.[2H][2H].
What is the InChIKey of CID 159555012?
The InChIKey is MFWKCYMAXJJFJD-HNLLKZFVSA-N. The full InChI is InChI=1S/C26H18BrF3N4O3S2.C18H10BrF3N4O2S2.H2/c1-37-19-5-2-16(3-6-19)14-34(25-32-15-33-38-25)39(35,36)20-7-9-21-17(12-20)10-11-31-24(21)22-8-4-18(13-23(22)27)26(28,29)30;19-15-8-11(18(20,21)22)1-3-14(15)16-13-4-2-12(7-10(13)5-6-23-16)30(27,28)26-17-24-9-25-29-17;/h2-13,15H,14H2,1H3;1-9H,(H,24,25,26);1H/i;;1+1D.
What are the key properties of CID 159555012?
CID 159555012 has a molecular weight of 1154.85 g/mol, XLogP of 12.52, 11 rotatable bonds, 1 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159555012 is sourced from PubChem (CID 159555012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).