About 1-ethyl-3-methyl-2H-imidazol-1-ium-1,2-dicarboxamide
1-ethyl-3-methyl-2H-imidazol-1-ium-1,2-dicarboxamide (PubChem CID 159557479) has the molecular formula C8H15N4O2+
and a molecular weight of 199.23 g/mol. Its IUPAC name is 1-ethyl-3-methyl-2H-imidazol-1-ium-1,2-dicarboxamide.
Molecular Properties
| Compound Name | 1-ethyl-3-methyl-2H-imidazol-1-ium-1,2-dicarboxamide |
| PubChem CID | 159557479 |
| Molecular Formula | C8H15N4O2+ |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 1-ethyl-3-methyl-2H-imidazol-1-ium-1,2-dicarboxamide |
| SMILES | CC[N+]1(C(N)=O)C=CN(C)C1C(N)=O |
| InChI | InChI=1S/C8H14N4O2/c1-3-12(8(10)14)5-4-11(2)7(12)6(9)13/h4-5,7H,3H2,1-2H3,(H3-,9,10,13,14)/p+1 |
| InChIKey | VJEWJYZLEOUSLB-UHFFFAOYSA-O |
| XLogP | -0.87 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-methyl-2H-imidazol-1-ium-1,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-methyl-2H-imidazol-1-ium-1,2-dicarboxamide?
The IUPAC name of 1-ethyl-3-methyl-2H-imidazol-1-ium-1,2-dicarboxamide (CID 159557479) is 1-ethyl-3-methyl-2H-imidazol-1-ium-1,2-dicarboxamide.
What is the SMILES notation for 1-ethyl-3-methyl-2H-imidazol-1-ium-1,2-dicarboxamide?
The canonical SMILES for 1-ethyl-3-methyl-2H-imidazol-1-ium-1,2-dicarboxamide is CC[N+]1(C(N)=O)C=CN(C)C1C(N)=O.
What is the InChIKey of 1-ethyl-3-methyl-2H-imidazol-1-ium-1,2-dicarboxamide?
The InChIKey is VJEWJYZLEOUSLB-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H14N4O2/c1-3-12(8(10)14)5-4-11(2)7(12)6(9)13/h4-5,7H,3H2,1-2H3,(H3-,9,10,13,14)/p+1.
What are the key properties of 1-ethyl-3-methyl-2H-imidazol-1-ium-1,2-dicarboxamide?
1-ethyl-3-methyl-2H-imidazol-1-ium-1,2-dicarboxamide has a molecular weight of 199.23 g/mol, XLogP of -0.87, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methyl-2H-imidazol-1-ium-1,2-dicarboxamide is sourced from PubChem (CID 159557479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).