About potassium;ethyl 2-[4-(dimethylamino)-4-thiophen-2-ylcyclohexylidene]acetate;2-methylpropan-2-olate
potassium;ethyl 2-[4-(dimethylamino)-4-thiophen-2-ylcyclohexylidene]acetate;2-methylpropan-2-olate (PubChem CID 159557704) has the molecular formula C20H32KNO3S
and a molecular weight of 405.65 g/mol. Its IUPAC name is potassium;ethyl 2-[4-(dimethylamino)-4-thiophen-2-ylcyclohexylidene]acetate;2-methylpropan-2-olate.
Molecular Properties
| Compound Name | potassium;ethyl 2-[4-(dimethylamino)-4-thiophen-2-ylcyclohexylidene]acetate;2-methylpropan-2-olate |
| PubChem CID | 159557704 |
| Molecular Formula | C20H32KNO3S |
| Molecular Weight | 405.65 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | potassium;ethyl 2-[4-(dimethylamino)-4-thiophen-2-ylcyclohexylidene]acetate;2-methylpropan-2-olate |
| SMILES | CC(C)(C)[O-].CCOC(=O)C=C1CCC(c2cccs2)(N(C)C)CC1.[K+] |
| InChI | InChI=1S/C16H23NO2S.C4H9O.K/c1-4-19-15(18)12-13-7-9-16(10-8-13,17(2)3)14-6-5-11-20-14;1-4(2,3)5;/h5-6,11-12H,4,7-10H2,1-3H3;1-3H3;/q;-1;+1/b13-12-;; |
| InChIKey | BCMZJDOBDNOSQI-RWYDNECBSA-N |
| XLogP | 0.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.65 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze potassium;ethyl 2-[4-(dimethylamino)-4-thiophen-2-ylcyclohexylidene]acetate;2-methylpropan-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;ethyl 2-[4-(dimethylamino)-4-thiophen-2-ylcyclohexylidene]acetate;2-methylpropan-2-olate?
The IUPAC name of potassium;ethyl 2-[4-(dimethylamino)-4-thiophen-2-ylcyclohexylidene]acetate;2-methylpropan-2-olate (CID 159557704) is potassium;ethyl 2-[4-(dimethylamino)-4-thiophen-2-ylcyclohexylidene]acetate;2-methylpropan-2-olate.
What is the SMILES notation for potassium;ethyl 2-[4-(dimethylamino)-4-thiophen-2-ylcyclohexylidene]acetate;2-methylpropan-2-olate?
The canonical SMILES for potassium;ethyl 2-[4-(dimethylamino)-4-thiophen-2-ylcyclohexylidene]acetate;2-methylpropan-2-olate is CC(C)(C)[O-].CCOC(=O)C=C1CCC(c2cccs2)(N(C)C)CC1.[K+].
What is the InChIKey of potassium;ethyl 2-[4-(dimethylamino)-4-thiophen-2-ylcyclohexylidene]acetate;2-methylpropan-2-olate?
The InChIKey is BCMZJDOBDNOSQI-RWYDNECBSA-N. The full InChI is InChI=1S/C16H23NO2S.C4H9O.K/c1-4-19-15(18)12-13-7-9-16(10-8-13,17(2)3)14-6-5-11-20-14;1-4(2,3)5;/h5-6,11-12H,4,7-10H2,1-3H3;1-3H3;/q;-1;+1/b13-12-;;.
What are the key properties of potassium;ethyl 2-[4-(dimethylamino)-4-thiophen-2-ylcyclohexylidene]acetate;2-methylpropan-2-olate?
potassium;ethyl 2-[4-(dimethylamino)-4-thiophen-2-ylcyclohexylidene]acetate;2-methylpropan-2-olate has a molecular weight of 405.65 g/mol, XLogP of 0.72, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;ethyl 2-[4-(dimethylamino)-4-thiophen-2-ylcyclohexylidene]acetate;2-methylpropan-2-olate is sourced from PubChem (CID 159557704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).