C27H19NO8 — CID 15955835
(3'S,4'R,5'S)-4'-(1,3-benzodioxol-5-ylcarbamoyl)-1,3-dioxo-5'-phenylspiro[indene-2,2'-oxolane]-3'-carboxylic acid (PubChem CID 15955835) has the molecular formula C27H19NO8 and a molecular weight of 485.45 g/mol. Its IUPAC name is (3'S,4'R,5'S)-4'-(1,3-benzodioxol-5-ylcarbamoyl)-1,3-dioxo-5'-phenylspiro[indene-2,2'-oxolane]-3'-carboxylic acid.
| Compound Name | (3'S,4'R,5'S)-4'-(1,3-benzodioxol-5-ylcarbamoyl)-1,3-dioxo-5'-phenylspiro[indene-2,2'-oxolane]-3'-carboxylic acid |
|---|---|
| PubChem CID | 15955835 |
| Molecular Formula | C27H19NO8 |
| Molecular Weight | 485.45 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | (3'S,4'R,5'S)-4'-(1,3-benzodioxol-5-ylcarbamoyl)-1,3-dioxo-5'-phenylspiro[indene-2,2'-oxolane]-3'-carboxylic acid |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)[C@H]1[C@@H](c2ccccc2)OC2(C(=O)c3ccccc3C2=O)[C@H]1C(=O)O |
| InChI | InChI=1S/C27H19NO8/c29-23-16-8-4-5-9-17(16)24(30)27(23)21(26(32)33)20(22(36-27)14-6-2-1-3-7-14)25(31)28-15-10-11-18-19(12-15)35-13-34-18/h1-12,20-22H,13H2,(H,28,31)(H,32,33)/t20-,21-,22-/m1/s1 |
| InChIKey | AUJJOTPRSJZPAI-YPAWHYETSA-N |
| XLogP | 3.26 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|