C23H26N2O2 — CID 15955924
(5Z,15E)-4-methoxy-23-oxa-24,25-diazatetracyclo[18.2.1.12,5.17,10]pentacosa-1(22),2(25),3,5,7,9,15,20-octaene (PubChem CID 15955924) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is (5Z,15E)-4-methoxy-23-oxa-24,25-diazatetracyclo[18.2.1.12,5.17,10]pentacosa-1(22),2(25),3,5,7,9,15,20-octaene.
| Compound Name | (5Z,15E)-4-methoxy-23-oxa-24,25-diazatetracyclo[18.2.1.12,5.17,10]pentacosa-1(22),2(25),3,5,7,9,15,20-octaene |
|---|---|
| PubChem CID | 15955924 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (5Z,15E)-4-methoxy-23-oxa-24,25-diazatetracyclo[18.2.1.12,5.17,10]pentacosa-1(22),2(25),3,5,7,9,15,20-octaene |
| SMILES | COC1=CC2=N/C1=C/c1ccc([nH]1)CCCC/C=C/CCCc1ccc2o1 |
| InChI | InChI=1S/C23H26N2O2/c1-26-23-16-21-22-14-13-19(27-22)10-8-6-4-2-3-5-7-9-17-11-12-18(24-17)15-20(23)25-21/h2,4,11-16,24H,3,5-10H2,1H3/b4-2+,20-15+ |
| InChIKey | HJMNUBVHAOYKGT-TXKIYPADSA-N |
| XLogP | 5.59 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|