C15H10N4O2S — CID 15956038
(NE)-N-[[2-(furan-2-yl)-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl]methylidene]hydroxylamine (PubChem CID 15956038) has the molecular formula C15H10N4O2S and a molecular weight of 310.34 g/mol. Its IUPAC name is (NE)-N-[[2-(furan-2-yl)-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[2-(furan-2-yl)-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 15956038 |
| Molecular Formula | C15H10N4O2S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | (NE)-N-[[2-(furan-2-yl)-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl]methylidene]hydroxylamine |
| SMILES | O/N=C/c1c(-c2ccccc2)nc2sc(-c3ccco3)nn12 |
| InChI | InChI=1S/C15H10N4O2S/c20-16-9-11-13(10-5-2-1-3-6-10)17-15-19(11)18-14(22-15)12-7-4-8-21-12/h1-9,20H/b16-9+ |
| InChIKey | QODLWOMHLCCCQC-CXUHLZMHSA-N |
| XLogP | 3.53 |
| TPSA | 75.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|