About methane;(2R)-pent-3-yn-2-ol;pent-3-yn-2-ol;pent-3-yn-2-yloxyphosphane
methane;(2R)-pent-3-yn-2-ol;pent-3-yn-2-ol;pent-3-yn-2-yloxyphosphane (PubChem CID 159561203) has the molecular formula C16H29O3P
and a molecular weight of 300.38 g/mol. Its IUPAC name is methane;(2R)-pent-3-yn-2-ol;pent-3-yn-2-ol;pent-3-yn-2-yloxyphosphane.
Molecular Properties
| Compound Name | methane;(2R)-pent-3-yn-2-ol;pent-3-yn-2-ol;pent-3-yn-2-yloxyphosphane |
| PubChem CID | 159561203 |
| Molecular Formula | C16H29O3P |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | methane;(2R)-pent-3-yn-2-ol;pent-3-yn-2-ol;pent-3-yn-2-yloxyphosphane |
| SMILES | C.CC#CC(C)O.CC#CC(C)OP.CC#C[C@@H](C)O |
| InChI | InChI=1S/C5H9OP.2C5H8O.CH4/c1-3-4-5(2)6-7;2*1-3-4-5(2)6;/h5H,7H2,1-2H3;2*5-6H,1-2H3;1H4/t;5-;;/m.1../s1 |
| InChIKey | MGQMFBDRUCRUHG-YEAWCGRSSA-N |
| XLogP | 2.62 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methane;(2R)-pent-3-yn-2-ol;pent-3-yn-2-ol;pent-3-yn-2-yloxyphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;(2R)-pent-3-yn-2-ol;pent-3-yn-2-ol;pent-3-yn-2-yloxyphosphane?
The IUPAC name of methane;(2R)-pent-3-yn-2-ol;pent-3-yn-2-ol;pent-3-yn-2-yloxyphosphane (CID 159561203) is methane;(2R)-pent-3-yn-2-ol;pent-3-yn-2-ol;pent-3-yn-2-yloxyphosphane.
What is the SMILES notation for methane;(2R)-pent-3-yn-2-ol;pent-3-yn-2-ol;pent-3-yn-2-yloxyphosphane?
The canonical SMILES for methane;(2R)-pent-3-yn-2-ol;pent-3-yn-2-ol;pent-3-yn-2-yloxyphosphane is C.CC#CC(C)O.CC#CC(C)OP.CC#C[C@@H](C)O.
What is the InChIKey of methane;(2R)-pent-3-yn-2-ol;pent-3-yn-2-ol;pent-3-yn-2-yloxyphosphane?
The InChIKey is MGQMFBDRUCRUHG-YEAWCGRSSA-N. The full InChI is InChI=1S/C5H9OP.2C5H8O.CH4/c1-3-4-5(2)6-7;2*1-3-4-5(2)6;/h5H,7H2,1-2H3;2*5-6H,1-2H3;1H4/t;5-;;/m.1../s1.
What are the key properties of methane;(2R)-pent-3-yn-2-ol;pent-3-yn-2-ol;pent-3-yn-2-yloxyphosphane?
methane;(2R)-pent-3-yn-2-ol;pent-3-yn-2-ol;pent-3-yn-2-yloxyphosphane has a molecular weight of 300.38 g/mol, XLogP of 2.62, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;(2R)-pent-3-yn-2-ol;pent-3-yn-2-ol;pent-3-yn-2-yloxyphosphane is sourced from PubChem (CID 159561203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).