C7HCl3F10 — CID 159561664
1-chloro-1,3,3,3-tetrafluoro-2-(trifluoromethyl)prop-1-ene;1,1-dichloro-3,3,3-trifluoroprop-1-ene (PubChem CID 159561664) has the molecular formula C7HCl3F10 and a molecular weight of 381.42 g/mol. Its IUPAC name is 1-chloro-1,3,3,3-tetrafluoro-2-(trifluoromethyl)prop-1-ene;1,1-dichloro-3,3,3-trifluoroprop-1-ene.
| Compound Name | 1-chloro-1,3,3,3-tetrafluoro-2-(trifluoromethyl)prop-1-ene;1,1-dichloro-3,3,3-trifluoroprop-1-ene |
|---|---|
| PubChem CID | 159561664 |
| Molecular Formula | C7HCl3F10 |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 379.90 |
| IUPAC Name | 1-chloro-1,3,3,3-tetrafluoro-2-(trifluoromethyl)prop-1-ene;1,1-dichloro-3,3,3-trifluoroprop-1-ene |
| SMILES | FC(Cl)=C(C(F)(F)F)C(F)(F)F.FC(F)(F)C=C(Cl)Cl |
| InChI | InChI=1S/C4ClF7.C3HCl2F3/c5-2(6)1(3(7,8)9)4(10,11)12;4-2(5)1-3(6,7)8/h;1H |
| InChIKey | MGRUPRXAPFJIFZ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |