C23H22N4OS — CID 15956172
6-(4-methylthiophen-2-yl)-N-(4-morpholin-4-ylphenyl)quinazolin-4-amine (PubChem CID 15956172) has the molecular formula C23H22N4OS and a molecular weight of 402.52 g/mol. Its IUPAC name is 6-(4-methylthiophen-2-yl)-N-(4-morpholin-4-ylphenyl)quinazolin-4-amine.
| Compound Name | 6-(4-methylthiophen-2-yl)-N-(4-morpholin-4-ylphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 15956172 |
| Molecular Formula | C23H22N4OS |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 6-(4-methylthiophen-2-yl)-N-(4-morpholin-4-ylphenyl)quinazolin-4-amine |
| SMILES | Cc1csc(-c2ccc3ncnc(Nc4ccc(N5CCOCC5)cc4)c3c2)c1 |
| InChI | InChI=1S/C23H22N4OS/c1-16-12-22(29-14-16)17-2-7-21-20(13-17)23(25-15-24-21)26-18-3-5-19(6-4-18)27-8-10-28-11-9-27/h2-7,12-15H,8-11H2,1H3,(H,24,25,26) |
| InChIKey | ITIRBSCRPSPMII-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|