About 2,3-dimethylcyclohexa-2,5-diene-1,4-diol
2,3-dimethylcyclohexa-2,5-diene-1,4-diol (PubChem CID 15956222) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is 2,3-dimethylcyclohexa-2,5-diene-1,4-diol.
Molecular Properties
| Compound Name | 2,3-dimethylcyclohexa-2,5-diene-1,4-diol |
| PubChem CID | 15956222 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 2,3-dimethylcyclohexa-2,5-diene-1,4-diol |
| SMILES | CC1=C(C)C(O)C=CC1O |
| InChI | InChI=1S/C8H12O2/c1-5-6(2)8(10)4-3-7(5)9/h3-4,7-10H,1-2H3 |
| InChIKey | LYUFISBDGKDSAI-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethylcyclohexa-2,5-diene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylcyclohexa-2,5-diene-1,4-diol?
The IUPAC name of 2,3-dimethylcyclohexa-2,5-diene-1,4-diol (CID 15956222) is 2,3-dimethylcyclohexa-2,5-diene-1,4-diol.
What is the SMILES notation for 2,3-dimethylcyclohexa-2,5-diene-1,4-diol?
The canonical SMILES for 2,3-dimethylcyclohexa-2,5-diene-1,4-diol is CC1=C(C)C(O)C=CC1O.
What is the InChIKey of 2,3-dimethylcyclohexa-2,5-diene-1,4-diol?
The InChIKey is LYUFISBDGKDSAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2/c1-5-6(2)8(10)4-3-7(5)9/h3-4,7-10H,1-2H3.
What are the key properties of 2,3-dimethylcyclohexa-2,5-diene-1,4-diol?
2,3-dimethylcyclohexa-2,5-diene-1,4-diol has a molecular weight of 140.18 g/mol, XLogP of 0.61, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylcyclohexa-2,5-diene-1,4-diol is sourced from PubChem (CID 15956222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).