C25H29N3O3 — CID 159562542
tert-butyl 6-(1-isocyano-3-phenylmethoxycyclobutyl)-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate (PubChem CID 159562542) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is tert-butyl 6-(1-isocyano-3-phenylmethoxycyclobutyl)-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate.
| Compound Name | tert-butyl 6-(1-isocyano-3-phenylmethoxycyclobutyl)-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 159562542 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | tert-butyl 6-(1-isocyano-3-phenylmethoxycyclobutyl)-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
| SMILES | [C-]#[N+]C1(c2ccc3c(n2)CCCN3C(=O)OC(C)(C)C)CC(OCc2ccccc2)C1 |
| InChI | InChI=1S/C25H29N3O3/c1-24(2,3)31-23(29)28-14-8-11-20-21(28)12-13-22(27-20)25(26-4)15-19(16-25)30-17-18-9-6-5-7-10-18/h5-7,9-10,12-13,19H,8,11,14-17H2,1-3H3 |
| InChIKey | ARYUGGKKRSNONZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 56.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|