About 2H-benzotriazole;1-hydroxyazepine
2H-benzotriazole;1-hydroxyazepine (PubChem CID 159562697) has the molecular formula C12H12N4O
and a molecular weight of 228.26 g/mol. Its IUPAC name is 2H-benzotriazole;1-hydroxyazepine.
Molecular Properties
| Compound Name | 2H-benzotriazole;1-hydroxyazepine |
| PubChem CID | 159562697 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2H-benzotriazole;1-hydroxyazepine |
| SMILES | ON1C=CC=CC=C1.c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C6H5N3.C6H7NO/c1-2-4-6-5(3-1)7-9-8-6;8-7-5-3-1-2-4-6-7/h1-4H,(H,7,8,9);1-6,8H |
| InChIKey | MGUYBGPLWRTGKN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2H-benzotriazole;1-hydroxyazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-benzotriazole;1-hydroxyazepine?
The IUPAC name of 2H-benzotriazole;1-hydroxyazepine (CID 159562697) is 2H-benzotriazole;1-hydroxyazepine.
What is the SMILES notation for 2H-benzotriazole;1-hydroxyazepine?
The canonical SMILES for 2H-benzotriazole;1-hydroxyazepine is ON1C=CC=CC=C1.c1ccc2n[nH]nc2c1.
What is the InChIKey of 2H-benzotriazole;1-hydroxyazepine?
The InChIKey is MGUYBGPLWRTGKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3.C6H7NO/c1-2-4-6-5(3-1)7-9-8-6;8-7-5-3-1-2-4-6-7/h1-4H,(H,7,8,9);1-6,8H.
What are the key properties of 2H-benzotriazole;1-hydroxyazepine?
2H-benzotriazole;1-hydroxyazepine has a molecular weight of 228.26 g/mol, XLogP of 2.23, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-benzotriazole;1-hydroxyazepine is sourced from PubChem (CID 159562697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).