C19H17N5O3 — CID 15956293
4-(2-ethyl-9-methyl-10-oxo-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-5-yl)-1H-pyrrole-2-carboxylic acid (PubChem CID 15956293) has the molecular formula C19H17N5O3 and a molecular weight of 363.38 g/mol. Its IUPAC name is 4-(2-ethyl-9-methyl-10-oxo-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-5-yl)-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-(2-ethyl-9-methyl-10-oxo-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-5-yl)-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 15956293 |
| Molecular Formula | C19H17N5O3 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 4-(2-ethyl-9-methyl-10-oxo-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-5-yl)-1H-pyrrole-2-carboxylic acid |
| SMILES | CCN1c2ncccc2C(=O)N(C)c2ccc(-c3c[nH]c(C(=O)O)c3)nc21 |
| InChI | InChI=1S/C19H17N5O3/c1-3-24-16-12(5-4-8-20-16)18(25)23(2)15-7-6-13(22-17(15)24)11-9-14(19(26)27)21-10-11/h4-10,21H,3H2,1-2H3,(H,26,27) |
| InChIKey | CIJVJFOYVXBEGO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |