About (2R)-1-[2-[5-chloro-2-(3,5-difluorophenyl)phenyl]acetyl]azetidine-2-carboxylic acid
(2R)-1-[2-[5-chloro-2-(3,5-difluorophenyl)phenyl]acetyl]azetidine-2-carboxylic acid (PubChem CID 159562983) has the molecular formula C18H14ClF2NO3
and a molecular weight of 365.76 g/mol. Its IUPAC name is (2R)-1-[2-[5-chloro-2-(3,5-difluorophenyl)phenyl]acetyl]azetidine-2-carboxylic acid.
Molecular Properties
| Compound Name | (2R)-1-[2-[5-chloro-2-(3,5-difluorophenyl)phenyl]acetyl]azetidine-2-carboxylic acid |
| PubChem CID | 159562983 |
| Molecular Formula | C18H14ClF2NO3 |
| Molecular Weight | 365.76 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | (2R)-1-[2-[5-chloro-2-(3,5-difluorophenyl)phenyl]acetyl]azetidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCN1C(=O)Cc1cc(Cl)ccc1-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C18H14ClF2NO3/c19-12-1-2-15(11-6-13(20)9-14(21)7-11)10(5-12)8-17(23)22-4-3-16(22)18(24)25/h1-2,5-7,9,16H,3-4,8H2,(H,24,25)/t16-/m1/s1 |
| InChIKey | MGVUSIGURDDFGN-MRXNPFEDSA-N |
| XLogP | 3.51 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.76 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-1-[2-[5-chloro-2-(3,5-difluorophenyl)phenyl]acetyl]azetidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[2-[5-chloro-2-(3,5-difluorophenyl)phenyl]acetyl]azetidine-2-carboxylic acid?
The IUPAC name of (2R)-1-[2-[5-chloro-2-(3,5-difluorophenyl)phenyl]acetyl]azetidine-2-carboxylic acid (CID 159562983) is (2R)-1-[2-[5-chloro-2-(3,5-difluorophenyl)phenyl]acetyl]azetidine-2-carboxylic acid.
What is the SMILES notation for (2R)-1-[2-[5-chloro-2-(3,5-difluorophenyl)phenyl]acetyl]azetidine-2-carboxylic acid?
The canonical SMILES for (2R)-1-[2-[5-chloro-2-(3,5-difluorophenyl)phenyl]acetyl]azetidine-2-carboxylic acid is O=C(O)[C@H]1CCN1C(=O)Cc1cc(Cl)ccc1-c1cc(F)cc(F)c1.
What is the InChIKey of (2R)-1-[2-[5-chloro-2-(3,5-difluorophenyl)phenyl]acetyl]azetidine-2-carboxylic acid?
The InChIKey is MGVUSIGURDDFGN-MRXNPFEDSA-N. The full InChI is InChI=1S/C18H14ClF2NO3/c19-12-1-2-15(11-6-13(20)9-14(21)7-11)10(5-12)8-17(23)22-4-3-16(22)18(24)25/h1-2,5-7,9,16H,3-4,8H2,(H,24,25)/t16-/m1/s1.
What are the key properties of (2R)-1-[2-[5-chloro-2-(3,5-difluorophenyl)phenyl]acetyl]azetidine-2-carboxylic acid?
(2R)-1-[2-[5-chloro-2-(3,5-difluorophenyl)phenyl]acetyl]azetidine-2-carboxylic acid has a molecular weight of 365.76 g/mol, XLogP of 3.51, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[2-[5-chloro-2-(3,5-difluorophenyl)phenyl]acetyl]azetidine-2-carboxylic acid is sourced from PubChem (CID 159562983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).