C24H23N5O — CID 15956313
2-ethyl-13-[2-(1H-indol-4-yl)ethyl]-9-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one (PubChem CID 15956313) has the molecular formula C24H23N5O and a molecular weight of 397.48 g/mol. Its IUPAC name is 2-ethyl-13-[2-(1H-indol-4-yl)ethyl]-9-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one.
| Compound Name | 2-ethyl-13-[2-(1H-indol-4-yl)ethyl]-9-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one |
|---|---|
| PubChem CID | 15956313 |
| Molecular Formula | C24H23N5O |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 2-ethyl-13-[2-(1H-indol-4-yl)ethyl]-9-methyl-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one |
| SMILES | CCN1c2ncc(CCc3cccc4[nH]ccc34)cc2C(=O)N(C)c2cccnc21 |
| InChI | InChI=1S/C24H23N5O/c1-3-29-22-19(24(30)28(2)21-8-5-12-26-23(21)29)14-16(15-27-22)9-10-17-6-4-7-20-18(17)11-13-25-20/h4-8,11-15,25H,3,9-10H2,1-2H3 |
| InChIKey | PUNGEWCLOBXINB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |