C24H24N4O3 — CID 15956327
methyl 4-[2-(2-ethyl-9-methyl-10-oxo-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-13-yl)ethyl]benzoate (PubChem CID 15956327) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is methyl 4-[2-(2-ethyl-9-methyl-10-oxo-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-13-yl)ethyl]benzoate.
| Compound Name | methyl 4-[2-(2-ethyl-9-methyl-10-oxo-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-13-yl)ethyl]benzoate |
|---|---|
| PubChem CID | 15956327 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | methyl 4-[2-(2-ethyl-9-methyl-10-oxo-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-13-yl)ethyl]benzoate |
| SMILES | CCN1c2ncc(CCc3ccc(C(=O)OC)cc3)cc2C(=O)N(C)c2cccnc21 |
| InChI | InChI=1S/C24H24N4O3/c1-4-28-21-19(23(29)27(2)20-6-5-13-25-22(20)28)14-17(15-26-21)8-7-16-9-11-18(12-10-16)24(30)31-3/h5-6,9-15H,4,7-8H2,1-3H3 |
| InChIKey | MERJXVNDVPAPBY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |