C15H14Cl2N2O4 — CID 159563322
2-chloro-5-methylpyridine-3-carboxylic acid;methyl 2-chloro-5-methylpyridine-3-carboxylate (PubChem CID 159563322) has the molecular formula C15H14Cl2N2O4 and a molecular weight of 357.19 g/mol. Its IUPAC name is 2-chloro-5-methylpyridine-3-carboxylic acid;methyl 2-chloro-5-methylpyridine-3-carboxylate.
| Compound Name | 2-chloro-5-methylpyridine-3-carboxylic acid;methyl 2-chloro-5-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 159563322 |
| Molecular Formula | C15H14Cl2N2O4 |
| Molecular Weight | 357.19 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 2-chloro-5-methylpyridine-3-carboxylic acid;methyl 2-chloro-5-methylpyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(C)cnc1Cl.Cc1cnc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C8H8ClNO2.C7H6ClNO2/c1-5-3-6(8(11)12-2)7(9)10-4-5;1-4-2-5(7(10)11)6(8)9-3-4/h3-4H,1-2H3;2-3H,1H3,(H,10,11) |
| InChIKey | MGWXHHAKKSXQTD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.19 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|