About (2'R,3S)-5-chloro-2'-phenylspiro[1H-indole-3,1'-cyclopropane]-2-one
(2'R,3S)-5-chloro-2'-phenylspiro[1H-indole-3,1'-cyclopropane]-2-one (PubChem CID 15956377) has the molecular formula C16H12ClNO
and a molecular weight of 269.73 g/mol. Its IUPAC name is (2'R,3S)-5-chloro-2'-phenylspiro[1H-indole-3,1'-cyclopropane]-2-one.
Molecular Properties
| Compound Name | (2'R,3S)-5-chloro-2'-phenylspiro[1H-indole-3,1'-cyclopropane]-2-one |
| PubChem CID | 15956377 |
| Molecular Formula | C16H12ClNO |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | (2'R,3S)-5-chloro-2'-phenylspiro[1H-indole-3,1'-cyclopropane]-2-one |
| SMILES | O=C1Nc2ccc(Cl)cc2[C@@]12C[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C16H12ClNO/c17-11-6-7-14-12(8-11)16(15(19)18-14)9-13(16)10-4-2-1-3-5-10/h1-8,13H,9H2,(H,18,19)/t13-,16-/m1/s1 |
| InChIKey | SVHBOFSQCAOODS-CZUORRHYSA-N |
| XLogP | 3.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2'R,3S)-5-chloro-2'-phenylspiro[1H-indole-3,1'-cyclopropane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2'R,3S)-5-chloro-2'-phenylspiro[1H-indole-3,1'-cyclopropane]-2-one?
The IUPAC name of (2'R,3S)-5-chloro-2'-phenylspiro[1H-indole-3,1'-cyclopropane]-2-one (CID 15956377) is (2'R,3S)-5-chloro-2'-phenylspiro[1H-indole-3,1'-cyclopropane]-2-one.
What is the SMILES notation for (2'R,3S)-5-chloro-2'-phenylspiro[1H-indole-3,1'-cyclopropane]-2-one?
The canonical SMILES for (2'R,3S)-5-chloro-2'-phenylspiro[1H-indole-3,1'-cyclopropane]-2-one is O=C1Nc2ccc(Cl)cc2[C@@]12C[C@@H]2c1ccccc1.
What is the InChIKey of (2'R,3S)-5-chloro-2'-phenylspiro[1H-indole-3,1'-cyclopropane]-2-one?
The InChIKey is SVHBOFSQCAOODS-CZUORRHYSA-N. The full InChI is InChI=1S/C16H12ClNO/c17-11-6-7-14-12(8-11)16(15(19)18-14)9-13(16)10-4-2-1-3-5-10/h1-8,13H,9H2,(H,18,19)/t13-,16-/m1/s1.
What are the key properties of (2'R,3S)-5-chloro-2'-phenylspiro[1H-indole-3,1'-cyclopropane]-2-one?
(2'R,3S)-5-chloro-2'-phenylspiro[1H-indole-3,1'-cyclopropane]-2-one has a molecular weight of 269.73 g/mol, XLogP of 3.72, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2'R,3S)-5-chloro-2'-phenylspiro[1H-indole-3,1'-cyclopropane]-2-one is sourced from PubChem (CID 15956377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).