C13H12INO3 — CID 15956410
ethyl (1'S,3S)-5-iodo-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-carboxylate (PubChem CID 15956410) has the molecular formula C13H12INO3 and a molecular weight of 357.15 g/mol. Its IUPAC name is ethyl (1'S,3S)-5-iodo-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-carboxylate.
| Compound Name | ethyl (1'S,3S)-5-iodo-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-carboxylate |
|---|---|
| PubChem CID | 15956410 |
| Molecular Formula | C13H12INO3 |
| Molecular Weight | 357.15 g/mol |
| Exact Mass | 356.99 |
| IUPAC Name | ethyl (1'S,3S)-5-iodo-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@]12C(=O)Nc1ccc(I)cc12 |
| InChI | InChI=1S/C13H12INO3/c1-2-18-11(16)9-6-13(9)8-5-7(14)3-4-10(8)15-12(13)17/h3-5,9H,2,6H2,1H3,(H,15,17)/t9-,13-/m1/s1 |
| InChIKey | UNNMUFIGEHHPBI-NOZJJQNGSA-N |
| XLogP | 2.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.15 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|