About methyl 2-(5-bromo-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-yl)acetate
methyl 2-(5-bromo-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-yl)acetate (PubChem CID 15956437) has the molecular formula C13H12BrNO3
and a molecular weight of 310.15 g/mol. Its IUPAC name is methyl 2-(5-bromo-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(5-bromo-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-yl)acetate |
| PubChem CID | 15956437 |
| Molecular Formula | C13H12BrNO3 |
| Molecular Weight | 310.15 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | methyl 2-(5-bromo-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-yl)acetate |
| SMILES | COC(=O)CC1CC12C(=O)Nc1ccc(Br)cc12 |
| InChI | InChI=1S/C13H12BrNO3/c1-18-11(16)4-7-6-13(7)9-5-8(14)2-3-10(9)15-12(13)17/h2-3,5,7H,4,6H2,1H3,(H,15,17) |
| InChIKey | WSYCBADDYIAWCU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.15 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-(5-bromo-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(5-bromo-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-yl)acetate?
The IUPAC name of methyl 2-(5-bromo-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-yl)acetate (CID 15956437) is methyl 2-(5-bromo-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-yl)acetate.
What is the SMILES notation for methyl 2-(5-bromo-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-yl)acetate?
The canonical SMILES for methyl 2-(5-bromo-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-yl)acetate is COC(=O)CC1CC12C(=O)Nc1ccc(Br)cc12.
What is the InChIKey of methyl 2-(5-bromo-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-yl)acetate?
The InChIKey is WSYCBADDYIAWCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BrNO3/c1-18-11(16)4-7-6-13(7)9-5-8(14)2-3-10(9)15-12(13)17/h2-3,5,7H,4,6H2,1H3,(H,15,17).
What are the key properties of methyl 2-(5-bromo-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-yl)acetate?
methyl 2-(5-bromo-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-yl)acetate has a molecular weight of 310.15 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(5-bromo-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-yl)acetate is sourced from PubChem (CID 15956437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).