About 5-bromo-2'-(phenoxymethyl)spiro[1H-indole-3,1'-cyclopropane]-2-one
5-bromo-2'-(phenoxymethyl)spiro[1H-indole-3,1'-cyclopropane]-2-one (PubChem CID 15956440) has the molecular formula C17H14BrNO2
and a molecular weight of 344.21 g/mol. Its IUPAC name is 5-bromo-2'-(phenoxymethyl)spiro[1H-indole-3,1'-cyclopropane]-2-one.
Molecular Properties
| Compound Name | 5-bromo-2'-(phenoxymethyl)spiro[1H-indole-3,1'-cyclopropane]-2-one |
| PubChem CID | 15956440 |
| Molecular Formula | C17H14BrNO2 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 5-bromo-2'-(phenoxymethyl)spiro[1H-indole-3,1'-cyclopropane]-2-one |
| SMILES | O=C1Nc2ccc(Br)cc2C12CC2COc1ccccc1 |
| InChI | InChI=1S/C17H14BrNO2/c18-12-6-7-15-14(8-12)17(16(20)19-15)9-11(17)10-21-13-4-2-1-3-5-13/h1-8,11H,9-10H2,(H,19,20) |
| InChIKey | PDEPHVGNADLLMU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-2'-(phenoxymethyl)spiro[1H-indole-3,1'-cyclopropane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2'-(phenoxymethyl)spiro[1H-indole-3,1'-cyclopropane]-2-one?
The IUPAC name of 5-bromo-2'-(phenoxymethyl)spiro[1H-indole-3,1'-cyclopropane]-2-one (CID 15956440) is 5-bromo-2'-(phenoxymethyl)spiro[1H-indole-3,1'-cyclopropane]-2-one.
What is the SMILES notation for 5-bromo-2'-(phenoxymethyl)spiro[1H-indole-3,1'-cyclopropane]-2-one?
The canonical SMILES for 5-bromo-2'-(phenoxymethyl)spiro[1H-indole-3,1'-cyclopropane]-2-one is O=C1Nc2ccc(Br)cc2C12CC2COc1ccccc1.
What is the InChIKey of 5-bromo-2'-(phenoxymethyl)spiro[1H-indole-3,1'-cyclopropane]-2-one?
The InChIKey is PDEPHVGNADLLMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BrNO2/c18-12-6-7-15-14(8-12)17(16(20)19-15)9-11(17)10-21-13-4-2-1-3-5-13/h1-8,11H,9-10H2,(H,19,20).
What are the key properties of 5-bromo-2'-(phenoxymethyl)spiro[1H-indole-3,1'-cyclopropane]-2-one?
5-bromo-2'-(phenoxymethyl)spiro[1H-indole-3,1'-cyclopropane]-2-one has a molecular weight of 344.21 g/mol, XLogP of 3.74, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2'-(phenoxymethyl)spiro[1H-indole-3,1'-cyclopropane]-2-one is sourced from PubChem (CID 15956440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).