About 2-chloro-6-methoxypyridine-4-carbonitrile;2,6-dichloropyridine-4-carbonitrile
2-chloro-6-methoxypyridine-4-carbonitrile;2,6-dichloropyridine-4-carbonitrile (PubChem CID 159564472) has the molecular formula C13H7Cl3N4O
and a molecular weight of 341.59 g/mol. Its IUPAC name is 2-chloro-6-methoxypyridine-4-carbonitrile;2,6-dichloropyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-chloro-6-methoxypyridine-4-carbonitrile;2,6-dichloropyridine-4-carbonitrile |
| PubChem CID | 159564472 |
| Molecular Formula | C13H7Cl3N4O |
| Molecular Weight | 341.59 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | 2-chloro-6-methoxypyridine-4-carbonitrile;2,6-dichloropyridine-4-carbonitrile |
| SMILES | COc1cc(C#N)cc(Cl)n1.N#Cc1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C7H5ClN2O.C6H2Cl2N2/c1-11-7-3-5(4-9)2-6(8)10-7;7-5-1-4(3-9)2-6(8)10-5/h2-3H,1H3;1-2H |
| InChIKey | MHAIRSOMACHCDY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 82.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-methoxypyridine-4-carbonitrile;2,6-dichloropyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-methoxypyridine-4-carbonitrile;2,6-dichloropyridine-4-carbonitrile?
The IUPAC name of 2-chloro-6-methoxypyridine-4-carbonitrile;2,6-dichloropyridine-4-carbonitrile (CID 159564472) is 2-chloro-6-methoxypyridine-4-carbonitrile;2,6-dichloropyridine-4-carbonitrile.
What is the SMILES notation for 2-chloro-6-methoxypyridine-4-carbonitrile;2,6-dichloropyridine-4-carbonitrile?
The canonical SMILES for 2-chloro-6-methoxypyridine-4-carbonitrile;2,6-dichloropyridine-4-carbonitrile is COc1cc(C#N)cc(Cl)n1.N#Cc1cc(Cl)nc(Cl)c1.
What is the InChIKey of 2-chloro-6-methoxypyridine-4-carbonitrile;2,6-dichloropyridine-4-carbonitrile?
The InChIKey is MHAIRSOMACHCDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN2O.C6H2Cl2N2/c1-11-7-3-5(4-9)2-6(8)10-7;7-5-1-4(3-9)2-6(8)10-5/h2-3H,1H3;1-2H.
What are the key properties of 2-chloro-6-methoxypyridine-4-carbonitrile;2,6-dichloropyridine-4-carbonitrile?
2-chloro-6-methoxypyridine-4-carbonitrile;2,6-dichloropyridine-4-carbonitrile has a molecular weight of 341.59 g/mol, XLogP of 3.88, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-methoxypyridine-4-carbonitrile;2,6-dichloropyridine-4-carbonitrile is sourced from PubChem (CID 159564472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).