C26H32N4O3 — CID 15956454
6-[3-[[1-(3-methylbutyl)benzimidazol-2-yl]methyl]-2-oxobenzimidazol-1-yl]hexanoic acid (PubChem CID 15956454) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is 6-[3-[[1-(3-methylbutyl)benzimidazol-2-yl]methyl]-2-oxobenzimidazol-1-yl]hexanoic acid.
| Compound Name | 6-[3-[[1-(3-methylbutyl)benzimidazol-2-yl]methyl]-2-oxobenzimidazol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 15956454 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 6-[3-[[1-(3-methylbutyl)benzimidazol-2-yl]methyl]-2-oxobenzimidazol-1-yl]hexanoic acid |
| SMILES | CC(C)CCn1c(Cn2c(=O)n(CCCCCC(=O)O)c3ccccc32)nc2ccccc21 |
| InChI | InChI=1S/C26H32N4O3/c1-19(2)15-17-28-21-11-6-5-10-20(21)27-24(28)18-30-23-13-8-7-12-22(23)29(26(30)33)16-9-3-4-14-25(31)32/h5-8,10-13,19H,3-4,9,14-18H2,1-2H3,(H,31,32) |
| InChIKey | QQJUPYVQKWDWRH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|