C12H19F3N6O — CID 159564677
2-(3,5-dimethyl-1,2,4-triazol-1-yl)ethanol;3,5-dimethyl-1-(2,2,2-trifluoroethyl)-1,2,4-triazole (PubChem CID 159564677) has the molecular formula C12H19F3N6O and a molecular weight of 320.32 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2,4-triazol-1-yl)ethanol;3,5-dimethyl-1-(2,2,2-trifluoroethyl)-1,2,4-triazole.
| Compound Name | 2-(3,5-dimethyl-1,2,4-triazol-1-yl)ethanol;3,5-dimethyl-1-(2,2,2-trifluoroethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 159564677 |
| Molecular Formula | C12H19F3N6O |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 2-(3,5-dimethyl-1,2,4-triazol-1-yl)ethanol;3,5-dimethyl-1-(2,2,2-trifluoroethyl)-1,2,4-triazole |
| SMILES | Cc1nc(C)n(CC(F)(F)F)n1.Cc1nc(C)n(CCO)n1 |
| InChI | InChI=1S/C6H8F3N3.C6H11N3O/c1-4-10-5(2)12(11-4)3-6(7,8)9;1-5-7-6(2)9(8-5)3-4-10/h3H2,1-2H3;10H,3-4H2,1-2H3 |
| InChIKey | MHAWZOKEXHDGMI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |