C20H16BCl3N4O2 — CID 159565009
4-chloro-6-phenylpyrimidine;4,6-dichloropyrimidine;phenylboronic acid (PubChem CID 159565009) has the molecular formula C20H16BCl3N4O2 and a molecular weight of 461.55 g/mol. Its IUPAC name is 4-chloro-6-phenylpyrimidine;4,6-dichloropyrimidine;phenylboronic acid.
| Compound Name | 4-chloro-6-phenylpyrimidine;4,6-dichloropyrimidine;phenylboronic acid |
|---|---|
| PubChem CID | 159565009 |
| Molecular Formula | C20H16BCl3N4O2 |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 4-chloro-6-phenylpyrimidine;4,6-dichloropyrimidine;phenylboronic acid |
| SMILES | Clc1cc(-c2ccccc2)ncn1.Clc1cc(Cl)ncn1.OB(O)c1ccccc1 |
| InChI | InChI=1S/C10H7ClN2.C6H7BO2.C4H2Cl2N2/c11-10-6-9(12-7-13-10)8-4-2-1-3-5-8;8-7(9)6-4-2-1-3-5-6;5-3-1-4(6)8-2-7-3/h1-7H;1-5,8-9H;1-2H |
| InChIKey | MHBYFCQMNKQTKV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|