C19H26O4 — CID 15956537
5-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,3-dimethoxycyclohexa-2,5-diene-1,4-dione (PubChem CID 15956537) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is 5-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,3-dimethoxycyclohexa-2,5-diene-1,4-dione.
| Compound Name | 5-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,3-dimethoxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 15956537 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 5-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,3-dimethoxycyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C(CC/C=C(\C)CCC=C(C)C)=CC1=O |
| InChI | InChI=1S/C19H26O4/c1-13(2)8-6-9-14(3)10-7-11-15-12-16(20)18(22-4)19(23-5)17(15)21/h8,10,12H,6-7,9,11H2,1-5H3/b14-10+ |
| InChIKey | BBVZEWLULQKSCZ-GXDHUFHOSA-N |
| XLogP | 4.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|