About 4-O-tert-butyl 2-O-ethyl 2-methylmorpholine-2,4-dicarboxylate;ethyl 2-methylmorpholine-2-carboxylate;methane
4-O-tert-butyl 2-O-ethyl 2-methylmorpholine-2,4-dicarboxylate;ethyl 2-methylmorpholine-2-carboxylate;methane (PubChem CID 159565564) has the molecular formula C22H42N2O8
and a molecular weight of 462.58 g/mol. Its IUPAC name is 4-O-tert-butyl 2-O-ethyl 2-methylmorpholine-2,4-dicarboxylate;ethyl 2-methylmorpholine-2-carboxylate;methane.
Molecular Properties
| Compound Name | 4-O-tert-butyl 2-O-ethyl 2-methylmorpholine-2,4-dicarboxylate;ethyl 2-methylmorpholine-2-carboxylate;methane |
| PubChem CID | 159565564 |
| Molecular Formula | C22H42N2O8 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | 4-O-tert-butyl 2-O-ethyl 2-methylmorpholine-2,4-dicarboxylate;ethyl 2-methylmorpholine-2-carboxylate;methane |
| SMILES | C.CCOC(=O)C1(C)CN(C(=O)OC(C)(C)C)CCO1.CCOC(=O)C1(C)CNCCO1 |
| InChI | InChI=1S/C13H23NO5.C8H15NO3.CH4/c1-6-17-10(15)13(5)9-14(7-8-18-13)11(16)19-12(2,3)4;1-3-11-7(10)8(2)6-9-4-5-12-8;/h6-9H2,1-5H3;9H,3-6H2,1-2H3;1H4 |
| InChIKey | MHDPWVIIKQEKJX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze 4-O-tert-butyl 2-O-ethyl 2-methylmorpholine-2,4-dicarboxylate;ethyl 2-methylmorpholine-2-carboxylate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-tert-butyl 2-O-ethyl 2-methylmorpholine-2,4-dicarboxylate;ethyl 2-methylmorpholine-2-carboxylate;methane?
The IUPAC name of 4-O-tert-butyl 2-O-ethyl 2-methylmorpholine-2,4-dicarboxylate;ethyl 2-methylmorpholine-2-carboxylate;methane (CID 159565564) is 4-O-tert-butyl 2-O-ethyl 2-methylmorpholine-2,4-dicarboxylate;ethyl 2-methylmorpholine-2-carboxylate;methane.
What is the SMILES notation for 4-O-tert-butyl 2-O-ethyl 2-methylmorpholine-2,4-dicarboxylate;ethyl 2-methylmorpholine-2-carboxylate;methane?
The canonical SMILES for 4-O-tert-butyl 2-O-ethyl 2-methylmorpholine-2,4-dicarboxylate;ethyl 2-methylmorpholine-2-carboxylate;methane is C.CCOC(=O)C1(C)CN(C(=O)OC(C)(C)C)CCO1.CCOC(=O)C1(C)CNCCO1.
What is the InChIKey of 4-O-tert-butyl 2-O-ethyl 2-methylmorpholine-2,4-dicarboxylate;ethyl 2-methylmorpholine-2-carboxylate;methane?
The InChIKey is MHDPWVIIKQEKJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO5.C8H15NO3.CH4/c1-6-17-10(15)13(5)9-14(7-8-18-13)11(16)19-12(2,3)4;1-3-11-7(10)8(2)6-9-4-5-12-8;/h6-9H2,1-5H3;9H,3-6H2,1-2H3;1H4.
What are the key properties of 4-O-tert-butyl 2-O-ethyl 2-methylmorpholine-2,4-dicarboxylate;ethyl 2-methylmorpholine-2-carboxylate;methane?
4-O-tert-butyl 2-O-ethyl 2-methylmorpholine-2,4-dicarboxylate;ethyl 2-methylmorpholine-2-carboxylate;methane has a molecular weight of 462.58 g/mol, XLogP of 2.14, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-tert-butyl 2-O-ethyl 2-methylmorpholine-2,4-dicarboxylate;ethyl 2-methylmorpholine-2-carboxylate;methane is sourced from PubChem (CID 159565564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).