C24H30ClN7O2S — CID 15956703
3-chloro-N-[3-(dimethylamino)propyl]-4-[[2-[1-(2,4,6-trimethylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzamide (PubChem CID 15956703) has the molecular formula C24H30ClN7O2S and a molecular weight of 516.07 g/mol. Its IUPAC name is 3-chloro-N-[3-(dimethylamino)propyl]-4-[[2-[1-(2,4,6-trimethylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzamide.
| Compound Name | 3-chloro-N-[3-(dimethylamino)propyl]-4-[[2-[1-(2,4,6-trimethylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 15956703 |
| Molecular Formula | C24H30ClN7O2S |
| Molecular Weight | 516.07 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | 3-chloro-N-[3-(dimethylamino)propyl]-4-[[2-[1-(2,4,6-trimethylphenyl)tetrazol-5-yl]sulfanylacetyl]amino]benzamide |
| SMILES | Cc1cc(C)c(-n2nnnc2SCC(=O)Nc2ccc(C(=O)NCCCN(C)C)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C24H30ClN7O2S/c1-15-11-16(2)22(17(3)12-15)32-24(28-29-30-32)35-14-21(33)27-20-8-7-18(13-19(20)25)23(34)26-9-6-10-31(4)5/h7-8,11-13H,6,9-10,14H2,1-5H3,(H,26,34)(H,27,33) |
| InChIKey | OXTPSDDMJCCDJL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.07 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|