C19H19NO7 — CID 15956737
(2R,4aR,6S,7R,8R,8aS)-2-(4-nitrophenyl)-6-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (PubChem CID 15956737) has the molecular formula C19H19NO7 and a molecular weight of 373.36 g/mol. Its IUPAC name is (2R,4aR,6S,7R,8R,8aS)-2-(4-nitrophenyl)-6-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol.
| Compound Name | (2R,4aR,6S,7R,8R,8aS)-2-(4-nitrophenyl)-6-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| PubChem CID | 15956737 |
| Molecular Formula | C19H19NO7 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | (2R,4aR,6S,7R,8R,8aS)-2-(4-nitrophenyl)-6-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| SMILES | O=[N+]([O-])c1ccc([C@@H]2OC[C@H]3O[C@@H](c4ccccc4)[C@H](O)[C@@H](O)[C@@H]3O2)cc1 |
| InChI | InChI=1S/C19H19NO7/c21-15-16(22)18-14(26-17(15)11-4-2-1-3-5-11)10-25-19(27-18)12-6-8-13(9-7-12)20(23)24/h1-9,14-19,21-22H,10H2/t14-,15-,16-,17+,18-,19-/m1/s1 |
| InChIKey | IJIJAJSWLPBRHR-WVXCVLBUSA-N |
| XLogP | 1.87 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|