C23H22O5 — CID 15956738
(2R,4aR,6S,7R,8R,8aS)-2-naphthalen-1-yl-6-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (PubChem CID 15956738) has the molecular formula C23H22O5 and a molecular weight of 378.42 g/mol. Its IUPAC name is (2R,4aR,6S,7R,8R,8aS)-2-naphthalen-1-yl-6-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol.
| Compound Name | (2R,4aR,6S,7R,8R,8aS)-2-naphthalen-1-yl-6-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| PubChem CID | 15956738 |
| Molecular Formula | C23H22O5 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | (2R,4aR,6S,7R,8R,8aS)-2-naphthalen-1-yl-6-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](c2ccccc2)O[C@@H]2CO[C@@H](c3cccc4ccccc34)O[C@@H]12 |
| InChI | InChI=1S/C23H22O5/c24-19-20(25)22-18(27-21(19)15-8-2-1-3-9-15)13-26-23(28-22)17-12-6-10-14-7-4-5-11-16(14)17/h1-12,18-25H,13H2/t18-,19-,20-,21+,22-,23-/m1/s1 |
| InChIKey | VJOAGXFCVHNIPL-FHJOOOADSA-N |
| XLogP | 3.12 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |