C21H30O5 — CID 15956739
(2R,4aR,6S,7S,8R,8aR)-2-cyclohexyl-7,8-dimethoxy-6-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 15956739) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is (2R,4aR,6S,7S,8R,8aR)-2-cyclohexyl-7,8-dimethoxy-6-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (2R,4aR,6S,7S,8R,8aR)-2-cyclohexyl-7,8-dimethoxy-6-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 15956739 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (2R,4aR,6S,7S,8R,8aR)-2-cyclohexyl-7,8-dimethoxy-6-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CO[C@@H]1[C@@H](OC)[C@H](c2ccccc2)O[C@@H]2CO[C@@H](C3CCCCC3)O[C@@H]12 |
| InChI | InChI=1S/C21H30O5/c1-22-19-17(14-9-5-3-6-10-14)25-16-13-24-21(15-11-7-4-8-12-15)26-18(16)20(19)23-2/h3,5-6,9-10,15-21H,4,7-8,11-13H2,1-2H3/t16-,17+,18-,19+,20+,21-/m1/s1 |
| InChIKey | SXXRRYCYTVOQCI-ZWJPJJENSA-N |
| XLogP | 3.48 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |