C15H18N4O3 — CID 159567542
11-tert-butyl-5-(oxetan-3-yl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione (PubChem CID 159567542) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 11-tert-butyl-5-(oxetan-3-yl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione.
| Compound Name | 11-tert-butyl-5-(oxetan-3-yl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione |
|---|---|
| PubChem CID | 159567542 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 11-tert-butyl-5-(oxetan-3-yl)-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione |
| SMILES | CC(C)(C)c1cc2nc3c(c(=O)n2[nH]1)CN(C1COC1)C3=O |
| InChI | InChI=1S/C15H18N4O3/c1-15(2,3)10-4-11-16-12-9(13(20)19(11)17-10)5-18(14(12)21)8-6-22-7-8/h4,8,17H,5-7H2,1-3H3 |
| InChIKey | UOFGIVAFMAKHPZ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |