C33H30N2O3 — CID 15956782
1-cyclohexyl-2-[4-[(3-phenylphenyl)methoxy]phenyl]benzimidazole-5-carboxylic acid (PubChem CID 15956782) has the molecular formula C33H30N2O3 and a molecular weight of 502.61 g/mol. Its IUPAC name is 1-cyclohexyl-2-[4-[(3-phenylphenyl)methoxy]phenyl]benzimidazole-5-carboxylic acid.
| Compound Name | 1-cyclohexyl-2-[4-[(3-phenylphenyl)methoxy]phenyl]benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 15956782 |
| Molecular Formula | C33H30N2O3 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | 1-cyclohexyl-2-[4-[(3-phenylphenyl)methoxy]phenyl]benzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)nc(-c1ccc(OCc3cccc(-c4ccccc4)c3)cc1)n2C1CCCCC1 |
| InChI | InChI=1S/C33H30N2O3/c36-33(37)27-16-19-31-30(21-27)34-32(35(31)28-12-5-2-6-13-28)25-14-17-29(18-15-25)38-22-23-8-7-11-26(20-23)24-9-3-1-4-10-24/h1,3-4,7-11,14-21,28H,2,5-6,12-13,22H2,(H,36,37) |
| InChIKey | NDLDNPSOGSPFET-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |