About cyclopentanecarboxylic acid;cyclopentyl(piperazin-1-yl)methanone
cyclopentanecarboxylic acid;cyclopentyl(piperazin-1-yl)methanone (PubChem CID 159568755) has the molecular formula C16H28N2O3
and a molecular weight of 296.41 g/mol. Its IUPAC name is cyclopentanecarboxylic acid;cyclopentyl(piperazin-1-yl)methanone.
Molecular Properties
| Compound Name | cyclopentanecarboxylic acid;cyclopentyl(piperazin-1-yl)methanone |
| PubChem CID | 159568755 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | cyclopentanecarboxylic acid;cyclopentyl(piperazin-1-yl)methanone |
| SMILES | O=C(C1CCCC1)N1CCNCC1.O=C(O)C1CCCC1 |
| InChI | InChI=1S/C10H18N2O.C6H10O2/c13-10(9-3-1-2-4-9)12-7-5-11-6-8-12;7-6(8)5-3-1-2-4-5/h9,11H,1-8H2;5H,1-4H2,(H,7,8) |
| InChIKey | MHNUJWJBQOOHAJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopentanecarboxylic acid;cyclopentyl(piperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentanecarboxylic acid;cyclopentyl(piperazin-1-yl)methanone?
The IUPAC name of cyclopentanecarboxylic acid;cyclopentyl(piperazin-1-yl)methanone (CID 159568755) is cyclopentanecarboxylic acid;cyclopentyl(piperazin-1-yl)methanone.
What is the SMILES notation for cyclopentanecarboxylic acid;cyclopentyl(piperazin-1-yl)methanone?
The canonical SMILES for cyclopentanecarboxylic acid;cyclopentyl(piperazin-1-yl)methanone is O=C(C1CCCC1)N1CCNCC1.O=C(O)C1CCCC1.
What is the InChIKey of cyclopentanecarboxylic acid;cyclopentyl(piperazin-1-yl)methanone?
The InChIKey is MHNUJWJBQOOHAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O.C6H10O2/c13-10(9-3-1-2-4-9)12-7-5-11-6-8-12;7-6(8)5-3-1-2-4-5/h9,11H,1-8H2;5H,1-4H2,(H,7,8).
What are the key properties of cyclopentanecarboxylic acid;cyclopentyl(piperazin-1-yl)methanone?
cyclopentanecarboxylic acid;cyclopentyl(piperazin-1-yl)methanone has a molecular weight of 296.41 g/mol, XLogP of 1.87, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentanecarboxylic acid;cyclopentyl(piperazin-1-yl)methanone is sourced from PubChem (CID 159568755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).