About (2S)-3-octoxypropane-1,2-diol
(2S)-3-octoxypropane-1,2-diol (PubChem CID 15956913) has the molecular formula C11H24O3
and a molecular weight of 204.31 g/mol. Its IUPAC name is (2S)-3-octoxypropane-1,2-diol.
Molecular Properties
| Compound Name | (2S)-3-octoxypropane-1,2-diol |
| PubChem CID | 15956913 |
| Molecular Formula | C11H24O3 |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | (2S)-3-octoxypropane-1,2-diol |
| SMILES | CCCCCCCCOC[C@@H](O)CO |
| InChI | InChI=1S/C11H24O3/c1-2-3-4-5-6-7-8-14-10-11(13)9-12/h11-13H,2-10H2,1H3/t11-/m0/s1 |
| InChIKey | GUPXYSSGJWIURR-NSHDSACASA-N |
| XLogP | 1.72 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-3-octoxypropane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-octoxypropane-1,2-diol?
The IUPAC name of (2S)-3-octoxypropane-1,2-diol (CID 15956913) is (2S)-3-octoxypropane-1,2-diol.
What is the SMILES notation for (2S)-3-octoxypropane-1,2-diol?
The canonical SMILES for (2S)-3-octoxypropane-1,2-diol is CCCCCCCCOC[C@@H](O)CO.
What is the InChIKey of (2S)-3-octoxypropane-1,2-diol?
The InChIKey is GUPXYSSGJWIURR-NSHDSACASA-N. The full InChI is InChI=1S/C11H24O3/c1-2-3-4-5-6-7-8-14-10-11(13)9-12/h11-13H,2-10H2,1H3/t11-/m0/s1.
What are the key properties of (2S)-3-octoxypropane-1,2-diol?
(2S)-3-octoxypropane-1,2-diol has a molecular weight of 204.31 g/mol, XLogP of 1.72, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-octoxypropane-1,2-diol is sourced from PubChem (CID 15956913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).