C33H41F3N8O2 — CID 159569785
1-[5-[2-[(4-aminocyclohexyl)amino]-8-ethylquinazolin-6-yl]-1-methylpyrazol-3-yl]-3-[4-pentoxy-3-(trifluoromethyl)phenyl]urea (PubChem CID 159569785) has the molecular formula C33H41F3N8O2 and a molecular weight of 638.74 g/mol. Its IUPAC name is 1-[5-[2-[(4-aminocyclohexyl)amino]-8-ethylquinazolin-6-yl]-1-methylpyrazol-3-yl]-3-[4-pentoxy-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[5-[2-[(4-aminocyclohexyl)amino]-8-ethylquinazolin-6-yl]-1-methylpyrazol-3-yl]-3-[4-pentoxy-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 159569785 |
| Molecular Formula | C33H41F3N8O2 |
| Molecular Weight | 638.74 g/mol |
| Exact Mass | 638.33 |
| IUPAC Name | 1-[5-[2-[(4-aminocyclohexyl)amino]-8-ethylquinazolin-6-yl]-1-methylpyrazol-3-yl]-3-[4-pentoxy-3-(trifluoromethyl)phenyl]urea |
| SMILES | CCCCCOc1ccc(NC(=O)Nc2cc(-c3cc(CC)c4nc(NC5CCC(N)CC5)ncc4c3)n(C)n2)cc1C(F)(F)F |
| InChI | InChI=1S/C33H41F3N8O2/c1-4-6-7-14-46-28-13-12-25(17-26(28)33(34,35)36)40-32(45)41-29-18-27(44(3)43-29)21-15-20(5-2)30-22(16-21)19-38-31(42-30)39-24-10-8-23(37)9-11-24/h12-13,15-19,23-24H,4-11,14,37H2,1-3H3,(H,38,39,42)(H2,40,41,43,45) |
| InChIKey | UEJMOOGWHGKFHX-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 132.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.74 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|