About (1,2-dimethylbenzimidazol-5-yl)methyl 2-(2-ethyl-4H-chromeno[4,3-c]pyrazol-3-yl)acetate
(1,2-dimethylbenzimidazol-5-yl)methyl 2-(2-ethyl-4H-chromeno[4,3-c]pyrazol-3-yl)acetate (PubChem CID 159571108) has the molecular formula C24H24N4O3
and a molecular weight of 416.48 g/mol. Its IUPAC name is (1,2-dimethylbenzimidazol-5-yl)methyl 2-(2-ethyl-4H-chromeno[4,3-c]pyrazol-3-yl)acetate.
Molecular Properties
| Compound Name | (1,2-dimethylbenzimidazol-5-yl)methyl 2-(2-ethyl-4H-chromeno[4,3-c]pyrazol-3-yl)acetate |
| PubChem CID | 159571108 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (1,2-dimethylbenzimidazol-5-yl)methyl 2-(2-ethyl-4H-chromeno[4,3-c]pyrazol-3-yl)acetate |
| SMILES | CCn1nc2c(c1CC(=O)OCc1ccc3c(c1)nc(C)n3C)COc1ccccc1-2 |
| InChI | InChI=1S/C24H24N4O3/c1-4-28-21(18-14-30-22-8-6-5-7-17(22)24(18)26-28)12-23(29)31-13-16-9-10-20-19(11-16)25-15(2)27(20)3/h5-11H,4,12-14H2,1-3H3 |
| InChIKey | MHVGBEZKXVOXHG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (1,2-dimethylbenzimidazol-5-yl)methyl 2-(2-ethyl-4H-chromeno[4,3-c]pyrazol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,2-dimethylbenzimidazol-5-yl)methyl 2-(2-ethyl-4H-chromeno[4,3-c]pyrazol-3-yl)acetate?
The IUPAC name of (1,2-dimethylbenzimidazol-5-yl)methyl 2-(2-ethyl-4H-chromeno[4,3-c]pyrazol-3-yl)acetate (CID 159571108) is (1,2-dimethylbenzimidazol-5-yl)methyl 2-(2-ethyl-4H-chromeno[4,3-c]pyrazol-3-yl)acetate.
What is the SMILES notation for (1,2-dimethylbenzimidazol-5-yl)methyl 2-(2-ethyl-4H-chromeno[4,3-c]pyrazol-3-yl)acetate?
The canonical SMILES for (1,2-dimethylbenzimidazol-5-yl)methyl 2-(2-ethyl-4H-chromeno[4,3-c]pyrazol-3-yl)acetate is CCn1nc2c(c1CC(=O)OCc1ccc3c(c1)nc(C)n3C)COc1ccccc1-2.
What is the InChIKey of (1,2-dimethylbenzimidazol-5-yl)methyl 2-(2-ethyl-4H-chromeno[4,3-c]pyrazol-3-yl)acetate?
The InChIKey is MHVGBEZKXVOXHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N4O3/c1-4-28-21(18-14-30-22-8-6-5-7-17(22)24(18)26-28)12-23(29)31-13-16-9-10-20-19(11-16)25-15(2)27(20)3/h5-11H,4,12-14H2,1-3H3.
What are the key properties of (1,2-dimethylbenzimidazol-5-yl)methyl 2-(2-ethyl-4H-chromeno[4,3-c]pyrazol-3-yl)acetate?
(1,2-dimethylbenzimidazol-5-yl)methyl 2-(2-ethyl-4H-chromeno[4,3-c]pyrazol-3-yl)acetate has a molecular weight of 416.48 g/mol, XLogP of 3.94, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1,2-dimethylbenzimidazol-5-yl)methyl 2-(2-ethyl-4H-chromeno[4,3-c]pyrazol-3-yl)acetate is sourced from PubChem (CID 159571108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).