About 2-(6-chloro-9H-fluoren-2-yl)propanoic acid;chloroplatinum;(2-methanidylcyclohexyl)azanide
2-(6-chloro-9H-fluoren-2-yl)propanoic acid;chloroplatinum;(2-methanidylcyclohexyl)azanide (PubChem CID 159571197) has the molecular formula C23H26Cl2NO2Pt-2
and a molecular weight of 614.45 g/mol. Its IUPAC name is 2-(6-chloro-9H-fluoren-2-yl)propanoic acid;chloroplatinum;(2-methanidylcyclohexyl)azanide.
Molecular Properties
| Compound Name | 2-(6-chloro-9H-fluoren-2-yl)propanoic acid;chloroplatinum;(2-methanidylcyclohexyl)azanide |
| PubChem CID | 159571197 |
| Molecular Formula | C23H26Cl2NO2Pt-2 |
| Molecular Weight | 614.45 g/mol |
| Exact Mass | 613.10 |
| IUPAC Name | 2-(6-chloro-9H-fluoren-2-yl)propanoic acid;chloroplatinum;(2-methanidylcyclohexyl)azanide |
| SMILES | CC(C(=O)O)c1ccc2c(c1)Cc1ccc(Cl)cc1-2.Cl[Pt].[CH2-]C1CCCCC1[NH-] |
| InChI | InChI=1S/C16H13ClO2.C7H13N.ClH.Pt/c1-9(16(18)19)10-3-5-14-12(6-10)7-11-2-4-13(17)8-15(11)14;1-6-4-2-3-5-7(6)8;;/h2-6,8-9H,7H2,1H3,(H,18,19);6-8H,1-5H2;1H;/q;-2;;+1/p-1 |
| InChIKey | DSTVNKTUKJLIBV-UHFFFAOYSA-M |
| XLogP | 7.22 |
| TPSA | 61.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 614.45 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-chloro-9H-fluoren-2-yl)propanoic acid;chloroplatinum;(2-methanidylcyclohexyl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-chloro-9H-fluoren-2-yl)propanoic acid;chloroplatinum;(2-methanidylcyclohexyl)azanide?
The IUPAC name of 2-(6-chloro-9H-fluoren-2-yl)propanoic acid;chloroplatinum;(2-methanidylcyclohexyl)azanide (CID 159571197) is 2-(6-chloro-9H-fluoren-2-yl)propanoic acid;chloroplatinum;(2-methanidylcyclohexyl)azanide.
What is the SMILES notation for 2-(6-chloro-9H-fluoren-2-yl)propanoic acid;chloroplatinum;(2-methanidylcyclohexyl)azanide?
The canonical SMILES for 2-(6-chloro-9H-fluoren-2-yl)propanoic acid;chloroplatinum;(2-methanidylcyclohexyl)azanide is CC(C(=O)O)c1ccc2c(c1)Cc1ccc(Cl)cc1-2.Cl[Pt].[CH2-]C1CCCCC1[NH-].
What is the InChIKey of 2-(6-chloro-9H-fluoren-2-yl)propanoic acid;chloroplatinum;(2-methanidylcyclohexyl)azanide?
The InChIKey is DSTVNKTUKJLIBV-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H13ClO2.C7H13N.ClH.Pt/c1-9(16(18)19)10-3-5-14-12(6-10)7-11-2-4-13(17)8-15(11)14;1-6-4-2-3-5-7(6)8;;/h2-6,8-9H,7H2,1H3,(H,18,19);6-8H,1-5H2;1H;/q;-2;;+1/p-1.
What are the key properties of 2-(6-chloro-9H-fluoren-2-yl)propanoic acid;chloroplatinum;(2-methanidylcyclohexyl)azanide?
2-(6-chloro-9H-fluoren-2-yl)propanoic acid;chloroplatinum;(2-methanidylcyclohexyl)azanide has a molecular weight of 614.45 g/mol, XLogP of 7.22, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloro-9H-fluoren-2-yl)propanoic acid;chloroplatinum;(2-methanidylcyclohexyl)azanide is sourced from PubChem (CID 159571197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).