About 1-bromo-4-nitrobenzene;1-nitro-4-phenylbenzene;phenylboronic acid
1-bromo-4-nitrobenzene;1-nitro-4-phenylbenzene;phenylboronic acid (PubChem CID 159571387) has the molecular formula C24H20BBrN2O6
and a molecular weight of 523.15 g/mol. Its IUPAC name is 1-bromo-4-nitrobenzene;1-nitro-4-phenylbenzene;phenylboronic acid.
Molecular Properties
| Compound Name | 1-bromo-4-nitrobenzene;1-nitro-4-phenylbenzene;phenylboronic acid |
| PubChem CID | 159571387 |
| Molecular Formula | C24H20BBrN2O6 |
| Molecular Weight | 523.15 g/mol |
| Exact Mass | 522.06 |
| IUPAC Name | 1-bromo-4-nitrobenzene;1-nitro-4-phenylbenzene;phenylboronic acid |
| SMILES | O=[N+]([O-])c1ccc(-c2ccccc2)cc1.O=[N+]([O-])c1ccc(Br)cc1.OB(O)c1ccccc1 |
| InChI | InChI=1S/C12H9NO2.C6H7BO2.C6H4BrNO2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10;8-7(9)6-4-2-1-3-5-6;7-5-1-3-6(4-2-5)8(9)10/h1-9H;1-5,8-9H;1-4H |
| InChIKey | MHWCPJBRZBETFI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 523.15 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-nitrobenzene;1-nitro-4-phenylbenzene;phenylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-nitrobenzene;1-nitro-4-phenylbenzene;phenylboronic acid?
The IUPAC name of 1-bromo-4-nitrobenzene;1-nitro-4-phenylbenzene;phenylboronic acid (CID 159571387) is 1-bromo-4-nitrobenzene;1-nitro-4-phenylbenzene;phenylboronic acid.
What is the SMILES notation for 1-bromo-4-nitrobenzene;1-nitro-4-phenylbenzene;phenylboronic acid?
The canonical SMILES for 1-bromo-4-nitrobenzene;1-nitro-4-phenylbenzene;phenylboronic acid is O=[N+]([O-])c1ccc(-c2ccccc2)cc1.O=[N+]([O-])c1ccc(Br)cc1.OB(O)c1ccccc1.
What is the InChIKey of 1-bromo-4-nitrobenzene;1-nitro-4-phenylbenzene;phenylboronic acid?
The InChIKey is MHWCPJBRZBETFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO2.C6H7BO2.C6H4BrNO2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10;8-7(9)6-4-2-1-3-5-6;7-5-1-3-6(4-2-5)8(9)10/h1-9H;1-5,8-9H;1-4H.
What are the key properties of 1-bromo-4-nitrobenzene;1-nitro-4-phenylbenzene;phenylboronic acid?
1-bromo-4-nitrobenzene;1-nitro-4-phenylbenzene;phenylboronic acid has a molecular weight of 523.15 g/mol, XLogP of 4.99, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-nitrobenzene;1-nitro-4-phenylbenzene;phenylboronic acid is sourced from PubChem (CID 159571387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).