C14H16O4 — CID 159571959
ethynylcyclopropane;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 159571959) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is ethynylcyclopropane;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | ethynylcyclopropane;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 159571959 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | ethynylcyclopropane;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | C#CC1CC1.CC1(C(=O)O)C=CC=C(C(=O)O)C1 |
| InChI | InChI=1S/C9H10O4.C5H6/c1-9(8(12)13)4-2-3-6(5-9)7(10)11;1-2-5-3-4-5/h2-4H,5H2,1H3,(H,10,11)(H,12,13);1,5H,3-4H2 |
| InChIKey | MHXVSBZEFWHEGH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|