About 1-[3-[(4-methoxyphenyl)methoxy]phenyl]-2-(4-methylphenyl)ethanone;sulfur monoxide
1-[3-[(4-methoxyphenyl)methoxy]phenyl]-2-(4-methylphenyl)ethanone;sulfur monoxide (PubChem CID 159572663) has the molecular formula C23H22O4S
and a molecular weight of 394.49 g/mol. Its IUPAC name is 1-[3-[(4-methoxyphenyl)methoxy]phenyl]-2-(4-methylphenyl)ethanone;sulfur monoxide.
Molecular Properties
| Compound Name | 1-[3-[(4-methoxyphenyl)methoxy]phenyl]-2-(4-methylphenyl)ethanone;sulfur monoxide |
| PubChem CID | 159572663 |
| Molecular Formula | C23H22O4S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 1-[3-[(4-methoxyphenyl)methoxy]phenyl]-2-(4-methylphenyl)ethanone;sulfur monoxide |
| SMILES | COc1ccc(COc2cccc(C(=O)Cc3ccc(C)cc3)c2)cc1.O=S |
| InChI | InChI=1S/C23H22O3.OS/c1-17-6-8-18(9-7-17)14-23(24)20-4-3-5-22(15-20)26-16-19-10-12-21(25-2)13-11-19;1-2/h3-13,15H,14,16H2,1-2H3; |
| InChIKey | MIAAWZYHUSVNCI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[3-[(4-methoxyphenyl)methoxy]phenyl]-2-(4-methylphenyl)ethanone;sulfur monoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[(4-methoxyphenyl)methoxy]phenyl]-2-(4-methylphenyl)ethanone;sulfur monoxide?
The IUPAC name of 1-[3-[(4-methoxyphenyl)methoxy]phenyl]-2-(4-methylphenyl)ethanone;sulfur monoxide (CID 159572663) is 1-[3-[(4-methoxyphenyl)methoxy]phenyl]-2-(4-methylphenyl)ethanone;sulfur monoxide.
What is the SMILES notation for 1-[3-[(4-methoxyphenyl)methoxy]phenyl]-2-(4-methylphenyl)ethanone;sulfur monoxide?
The canonical SMILES for 1-[3-[(4-methoxyphenyl)methoxy]phenyl]-2-(4-methylphenyl)ethanone;sulfur monoxide is COc1ccc(COc2cccc(C(=O)Cc3ccc(C)cc3)c2)cc1.O=S.
What is the InChIKey of 1-[3-[(4-methoxyphenyl)methoxy]phenyl]-2-(4-methylphenyl)ethanone;sulfur monoxide?
The InChIKey is MIAAWZYHUSVNCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22O3.OS/c1-17-6-8-18(9-7-17)14-23(24)20-4-3-5-22(15-20)26-16-19-10-12-21(25-2)13-11-19;1-2/h3-13,15H,14,16H2,1-2H3;.
What are the key properties of 1-[3-[(4-methoxyphenyl)methoxy]phenyl]-2-(4-methylphenyl)ethanone;sulfur monoxide?
1-[3-[(4-methoxyphenyl)methoxy]phenyl]-2-(4-methylphenyl)ethanone;sulfur monoxide has a molecular weight of 394.49 g/mol, XLogP of 4.67, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[(4-methoxyphenyl)methoxy]phenyl]-2-(4-methylphenyl)ethanone;sulfur monoxide is sourced from PubChem (CID 159572663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).