C23H22N2O3 — CID 159573028
2-[[(2S)-3-oxo-1-phenyl-4-(3-pyridin-4-ylphenyl)butan-2-yl]amino]acetic acid (PubChem CID 159573028) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-[[(2S)-3-oxo-1-phenyl-4-(3-pyridin-4-ylphenyl)butan-2-yl]amino]acetic acid.
| Compound Name | 2-[[(2S)-3-oxo-1-phenyl-4-(3-pyridin-4-ylphenyl)butan-2-yl]amino]acetic acid |
|---|---|
| PubChem CID | 159573028 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-[[(2S)-3-oxo-1-phenyl-4-(3-pyridin-4-ylphenyl)butan-2-yl]amino]acetic acid |
| SMILES | O=C(O)CN[C@@H](Cc1ccccc1)C(=O)Cc1cccc(-c2ccncc2)c1 |
| InChI | InChI=1S/C23H22N2O3/c26-22(21(25-16-23(27)28)14-17-5-2-1-3-6-17)15-18-7-4-8-20(13-18)19-9-11-24-12-10-19/h1-13,21,25H,14-16H2,(H,27,28)/t21-/m0/s1 |
| InChIKey | BPZFYAVEOLQGRB-NRFANRHFSA-N |
| XLogP | 3.15 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |