C24H46O4Si2 — CID 159573847
(3S,4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-1-yn-3-ol;(4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-1-yn-3-one (PubChem CID 159573847) has the molecular formula C24H46O4Si2 and a molecular weight of 454.80 g/mol. Its IUPAC name is (3S,4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-1-yn-3-ol;(4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-1-yn-3-one.
| Compound Name | (3S,4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-1-yn-3-ol;(4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-1-yn-3-one |
|---|---|
| PubChem CID | 159573847 |
| Molecular Formula | C24H46O4Si2 |
| Molecular Weight | 454.80 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | (3S,4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-1-yn-3-ol;(4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-1-yn-3-one |
| SMILES | C#CC(=O)[C@@H](C)CO[Si](C)(C)C(C)(C)C.C#C[C@@H](O)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H24O2Si.C12H22O2Si/c2*1-8-11(13)10(2)9-14-15(6,7)12(3,4)5/h1,10-11,13H,9H2,2-7H3;1,10H,9H2,2-7H3/t10-,11+;10-/m00/s1 |
| InChIKey | MIDQBULLOWUCCT-ZVBYIBDDSA-N |
| XLogP | 5.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.80 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|