C25H29N5O — CID 159575062
8,8-bis[4-(dimethylamino)-2-methylphenyl]-6,7-dihydropyrido[2,3-d]pyridazin-5-one (PubChem CID 159575062) has the molecular formula C25H29N5O and a molecular weight of 415.54 g/mol. Its IUPAC name is 8,8-bis[4-(dimethylamino)-2-methylphenyl]-6,7-dihydropyrido[2,3-d]pyridazin-5-one.
| Compound Name | 8,8-bis[4-(dimethylamino)-2-methylphenyl]-6,7-dihydropyrido[2,3-d]pyridazin-5-one |
|---|---|
| PubChem CID | 159575062 |
| Molecular Formula | C25H29N5O |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 8,8-bis[4-(dimethylamino)-2-methylphenyl]-6,7-dihydropyrido[2,3-d]pyridazin-5-one |
| SMILES | Cc1cc(N(C)C)ccc1C1(c2ccc(N(C)C)cc2C)NNC(=O)c2cccnc21 |
| InChI | InChI=1S/C25H29N5O/c1-16-14-18(29(3)4)9-11-21(16)25(22-12-10-19(30(5)6)15-17(22)2)23-20(8-7-13-26-23)24(31)27-28-25/h7-15,28H,1-6H3,(H,27,31) |
| InChIKey | MIHJGJKGXKSQPL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|