About (1Z)-3,6-dimethylcyclooctene
(1Z)-3,6-dimethylcyclooctene (PubChem CID 159575743) has the molecular formula C10H18
and a molecular weight of 138.25 g/mol. Its IUPAC name is (1Z)-3,6-dimethylcyclooctene.
Molecular Properties
| Compound Name | (1Z)-3,6-dimethylcyclooctene |
| PubChem CID | 159575743 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | (1Z)-3,6-dimethylcyclooctene |
| SMILES | CC1/C=C\CCC(C)CC1 |
| InChI | InChI=1S/C10H18/c1-9-5-3-4-6-10(2)8-7-9/h3,5,9-10H,4,6-8H2,1-2H3/b5-3- |
| InChIKey | ACYPRRYTEBOZKD-HYXAFXHYSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-3,6-dimethylcyclooctene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-3,6-dimethylcyclooctene?
The IUPAC name of (1Z)-3,6-dimethylcyclooctene (CID 159575743) is (1Z)-3,6-dimethylcyclooctene.
What is the SMILES notation for (1Z)-3,6-dimethylcyclooctene?
The canonical SMILES for (1Z)-3,6-dimethylcyclooctene is CC1/C=C\CCC(C)CC1.
What is the InChIKey of (1Z)-3,6-dimethylcyclooctene?
The InChIKey is ACYPRRYTEBOZKD-HYXAFXHYSA-N. The full InChI is InChI=1S/C10H18/c1-9-5-3-4-6-10(2)8-7-9/h3,5,9-10H,4,6-8H2,1-2H3/b5-3-.
What are the key properties of (1Z)-3,6-dimethylcyclooctene?
(1Z)-3,6-dimethylcyclooctene has a molecular weight of 138.25 g/mol, XLogP of 3.39, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-3,6-dimethylcyclooctene is sourced from PubChem (CID 159575743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).