About chloromethane;2-methylpropane
chloromethane;2-methylpropane (PubChem CID 159576312) has the molecular formula C5H13Cl
and a molecular weight of 108.61 g/mol. Its IUPAC name is chloromethane;2-methylpropane.
Molecular Properties
| Compound Name | chloromethane;2-methylpropane |
| PubChem CID | 159576312 |
| Molecular Formula | C5H13Cl |
| Molecular Weight | 108.61 g/mol |
| Exact Mass | 108.07 |
| IUPAC Name | chloromethane;2-methylpropane |
| SMILES | CC(C)C.CCl |
| InChI | InChI=1S/C4H10.CH3Cl/c1-4(2)3;1-2/h4H,1-3H3;1H3 |
| InChIKey | MILIKYKHHCRVDN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.61 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;2-methylpropane?
The IUPAC name of chloromethane;2-methylpropane (CID 159576312) is chloromethane;2-methylpropane.
What is the SMILES notation for chloromethane;2-methylpropane?
The canonical SMILES for chloromethane;2-methylpropane is CC(C)C.CCl.
What is the InChIKey of chloromethane;2-methylpropane?
The InChIKey is MILIKYKHHCRVDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.CH3Cl/c1-4(2)3;1-2/h4H,1-3H3;1H3.
What are the key properties of chloromethane;2-methylpropane?
chloromethane;2-methylpropane has a molecular weight of 108.61 g/mol, XLogP of 2.52, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;2-methylpropane is sourced from PubChem (CID 159576312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).