C26H26F3N5O2 — CID 159576333
[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(5-morpholin-4-yl-3-pyridinyl)methanone (PubChem CID 159576333) has the molecular formula C26H26F3N5O2 and a molecular weight of 497.52 g/mol. Its IUPAC name is [(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(5-morpholin-4-yl-3-pyridinyl)methanone.
| Compound Name | [(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(5-morpholin-4-yl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 159576333 |
| Molecular Formula | C26H26F3N5O2 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | [(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(5-morpholin-4-yl-3-pyridinyl)methanone |
| SMILES | Cn1nc2c(c1-c1cc(F)c(F)c(F)c1)C[C@@H]1CCC[C@H]2N1C(=O)c1cncc(N2CCOCC2)c1 |
| InChI | InChI=1S/C26H26F3N5O2/c1-32-25(15-10-20(27)23(29)21(28)11-15)19-12-17-3-2-4-22(24(19)31-32)34(17)26(35)16-9-18(14-30-13-16)33-5-7-36-8-6-33/h9-11,13-14,17,22H,2-8,12H2,1H3/t17-,22+/m0/s1 |
| InChIKey | MILJYTRHNZPGTH-HTAPYJJXSA-N |
| XLogP | 4.03 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|