C27H33ClN2O6S — CID 159576742
tert-butyl 2-[(3R)-1-[(4-chlorophenyl)methyl]-8-hexanoyl-2,5,5-trioxo-3,4-dihydropyrido[3,4-b][1,4]thiazepin-3-yl]acetate (PubChem CID 159576742) has the molecular formula C27H33ClN2O6S and a molecular weight of 549.09 g/mol. Its IUPAC name is tert-butyl 2-[(3R)-1-[(4-chlorophenyl)methyl]-8-hexanoyl-2,5,5-trioxo-3,4-dihydropyrido[3,4-b][1,4]thiazepin-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3R)-1-[(4-chlorophenyl)methyl]-8-hexanoyl-2,5,5-trioxo-3,4-dihydropyrido[3,4-b][1,4]thiazepin-3-yl]acetate |
|---|---|
| PubChem CID | 159576742 |
| Molecular Formula | C27H33ClN2O6S |
| Molecular Weight | 549.09 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | tert-butyl 2-[(3R)-1-[(4-chlorophenyl)methyl]-8-hexanoyl-2,5,5-trioxo-3,4-dihydropyrido[3,4-b][1,4]thiazepin-3-yl]acetate |
| SMILES | CCCCCC(=O)c1cc2c(cn1)S(=O)(=O)C[C@H](CC(=O)OC(C)(C)C)C(=O)N2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H33ClN2O6S/c1-5-6-7-8-23(31)21-14-22-24(15-29-21)37(34,35)17-19(13-25(32)36-27(2,3)4)26(33)30(22)16-18-9-11-20(28)12-10-18/h9-12,14-15,19H,5-8,13,16-17H2,1-4H3/t19-/m0/s1 |
| InChIKey | NCTCFLUYDUMWPJ-IBGZPJMESA-N |
| XLogP | 5.17 |
| TPSA | 110.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.09 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|