C31H32N2O8 — CID 15957681
[(2R,3S,4S,5R)-5-[5-(3,3-dimethylbut-1-ynyl)-2,4-dioxopyrimidin-1-yl]-4-hydroxy-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate (PubChem CID 15957681) has the molecular formula C31H32N2O8 and a molecular weight of 560.60 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-[5-(3,3-dimethylbut-1-ynyl)-2,4-dioxopyrimidin-1-yl]-4-hydroxy-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(2R,3S,4S,5R)-5-[5-(3,3-dimethylbut-1-ynyl)-2,4-dioxopyrimidin-1-yl]-4-hydroxy-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 15957681 |
| Molecular Formula | C31H32N2O8 |
| Molecular Weight | 560.60 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | [(2R,3S,4S,5R)-5-[5-(3,3-dimethylbut-1-ynyl)-2,4-dioxopyrimidin-1-yl]-4-hydroxy-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC[C@H]2O[C@@H](n3cc(C#CC(C)(C)C)c(=O)[nH]c3=O)[C@@H](O)[C@@H]2OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H32N2O8/c1-18-6-10-20(11-7-18)28(36)39-17-23-25(41-29(37)21-12-8-19(2)9-13-21)24(34)27(40-23)33-16-22(14-15-31(3,4)5)26(35)32-30(33)38/h6-13,16,23-25,27,34H,17H2,1-5H3,(H,32,35,38)/t23-,24+,25-,27-/m1/s1 |
| InChIKey | MATADGHSITZMQM-SPGPFUFCSA-N |
| XLogP | 2.89 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.60 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|